C18H14BrN3O4S — CID 16520404
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate (PubChem CID 16520404) has the molecular formula C18H14BrN3O4S and a molecular weight of 448.30 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16520404 |
| Molecular Formula | C18H14BrN3O4S |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)OCC(=O)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C18H14BrN3O4S/c1-25-15-7-6-12(19)9-11(15)5-8-17(24)26-10-16(23)20-13-3-2-4-14-18(13)22-27-21-14/h2-9H,10H2,1H3,(H,20,23)/b8-5+ |
| InChIKey | IUERCYLRARLOSG-VMPITWQZSA-N |
| XLogP | 3.66 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|