C26H23N3O5S — CID 2555908
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 2555908) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2555908 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCC(=O)Nc2cccc3nsnc23)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H23N3O5S/c1-2-32-23-15-18(11-13-22(23)33-16-19-7-4-3-5-8-19)12-14-25(31)34-17-24(30)27-20-9-6-10-21-26(20)29-35-28-21/h3-15H,2,16-17H2,1H3,(H,27,30)/b14-12+ |
| InChIKey | OSUHEGCBQLYRGD-WYMLVPIESA-N |
| XLogP | 4.86 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|