C7H3ClN2O2S — CID 130495635
5-chloro-2,1,3-benzothiadiazole-4-carboxylic acid (PubChem CID 130495635) has the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. Its IUPAC name is 5-chloro-2,1,3-benzothiadiazole-4-carboxylic acid.
| Compound Name | 5-chloro-2,1,3-benzothiadiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 130495635 |
| Molecular Formula | C7H3ClN2O2S |
| Molecular Weight | 214.63 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | 5-chloro-2,1,3-benzothiadiazole-4-carboxylic acid |
| SMILES | O=C(O)c1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C7H3ClN2O2S/c8-3-1-2-4-6(10-13-9-4)5(3)7(11)12/h1-2H,(H,11,12) |
| InChIKey | MALDZYKCWCMWPQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.63 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |