C12H13ClN4O3S — CID 65452554
5-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamoylamino]pentanoic acid (PubChem CID 65452554) has the molecular formula C12H13ClN4O3S and a molecular weight of 328.78 g/mol. Its IUPAC name is 5-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamoylamino]pentanoic acid.
| Compound Name | 5-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 65452554 |
| Molecular Formula | C12H13ClN4O3S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 5-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamoylamino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C12H13ClN4O3S/c13-7-4-5-8-11(17-21-16-8)10(7)15-12(20)14-6-2-1-3-9(18)19/h4-5H,1-3,6H2,(H,18,19)(H2,14,15,20) |
| InChIKey | WXWWRZXLHPUGAW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|