C12H16ClN3S — CID 65473471
5-chloro-N-hexyl-2,1,3-benzothiadiazol-4-amine (PubChem CID 65473471) has the molecular formula C12H16ClN3S and a molecular weight of 269.80 g/mol. Its IUPAC name is 5-chloro-N-hexyl-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5-chloro-N-hexyl-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 65473471 |
| Molecular Formula | C12H16ClN3S |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 5-chloro-N-hexyl-2,1,3-benzothiadiazol-4-amine |
| SMILES | CCCCCCNc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C12H16ClN3S/c1-2-3-4-5-8-14-11-9(13)6-7-10-12(11)16-17-15-10/h6-7,14H,2-5,8H2,1H3 |
| InChIKey | BVESLMCLGDAAHJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|