C9H10ClN3OS — CID 65474285
5-chloro-N-(2-methoxyethyl)-2,1,3-benzothiadiazol-4-amine (PubChem CID 65474285) has the molecular formula C9H10ClN3OS and a molecular weight of 243.72 g/mol. Its IUPAC name is 5-chloro-N-(2-methoxyethyl)-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5-chloro-N-(2-methoxyethyl)-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 65474285 |
| Molecular Formula | C9H10ClN3OS |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 5-chloro-N-(2-methoxyethyl)-2,1,3-benzothiadiazol-4-amine |
| SMILES | COCCNc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C9H10ClN3OS/c1-14-5-4-11-8-6(10)2-3-7-9(8)13-15-12-7/h2-3,11H,4-5H2,1H3 |
| InChIKey | FJDVGWUURRTHGA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|