C9H6ClN3S — CID 65473847
5-chloro-N-prop-2-ynyl-2,1,3-benzothiadiazol-4-amine (PubChem CID 65473847) has the molecular formula C9H6ClN3S and a molecular weight of 223.69 g/mol. Its IUPAC name is 5-chloro-N-prop-2-ynyl-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5-chloro-N-prop-2-ynyl-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 65473847 |
| Molecular Formula | C9H6ClN3S |
| Molecular Weight | 223.69 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 5-chloro-N-prop-2-ynyl-2,1,3-benzothiadiazol-4-amine |
| SMILES | C#CCNc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C9H6ClN3S/c1-2-5-11-8-6(10)3-4-7-9(8)13-14-12-7/h1,3-4,11H,5H2 |
| InChIKey | NFMGCCYLHDGQHE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.69 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|