C11H13ClN4OS2 — CID 116509048
1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-(1-methoxypropan-2-yl)thiourea (PubChem CID 116509048) has the molecular formula C11H13ClN4OS2 and a molecular weight of 316.84 g/mol. Its IUPAC name is 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-(1-methoxypropan-2-yl)thiourea.
| Compound Name | 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-(1-methoxypropan-2-yl)thiourea |
|---|---|
| PubChem CID | 116509048 |
| Molecular Formula | C11H13ClN4OS2 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-(1-methoxypropan-2-yl)thiourea |
| SMILES | COCC(C)NC(=S)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C11H13ClN4OS2/c1-6(5-17-2)13-11(18)14-9-7(12)3-4-8-10(9)16-19-15-8/h3-4,6H,5H2,1-2H3,(H2,13,14,18) |
| InChIKey | BFLPNFPNRRDHCE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|