C13H17Cl2N3OS — CID 9175980
1-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea (PubChem CID 9175980) has the molecular formula C13H17Cl2N3OS and a molecular weight of 334.27 g/mol. Its IUPAC name is 1-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9175980 |
| Molecular Formula | C13H17Cl2N3OS |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 1-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
| SMILES | COC[C@H](C)NC(=S)N/N=C(/C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N3OS/c1-8(7-19-3)16-13(20)18-17-9(2)10-4-5-11(14)12(15)6-10/h4-6,8H,7H2,1-3H3,(H2,16,18,20)/b17-9-/t8-/m0/s1 |
| InChIKey | HPCXXWPWRLITAS-KNZYWQTRSA-N |
| XLogP | 3.22 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|