C19H30FN5OS — CID 9175665
1-[(Z)-1-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]ethylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea (PubChem CID 9175665) has the molecular formula C19H30FN5OS and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-[(Z)-1-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]ethylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[(Z)-1-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]ethylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9175665 |
| Molecular Formula | C19H30FN5OS |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-[(Z)-1-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]ethylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
| SMILES | CCN1CCN(c2ccc(/C(C)=N\NC(=S)N[C@H](C)COC)cc2F)CC1 |
| InChI | InChI=1S/C19H30FN5OS/c1-5-24-8-10-25(11-9-24)18-7-6-16(12-17(18)20)15(3)22-23-19(27)21-14(2)13-26-4/h6-7,12,14H,5,8-11,13H2,1-4H3,(H2,21,23,27)/b22-15-/t14-/m1/s1 |
| InChIKey | ZCCZUYBZQFGFSN-HHSBIGSDSA-N |
| XLogP | 2.19 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|