C13H18IN3OS — CID 9175613
1-[(Z)-1-(4-iodophenyl)ethylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea (PubChem CID 9175613) has the molecular formula C13H18IN3OS and a molecular weight of 391.28 g/mol. Its IUPAC name is 1-[(Z)-1-(4-iodophenyl)ethylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[(Z)-1-(4-iodophenyl)ethylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9175613 |
| Molecular Formula | C13H18IN3OS |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 1-[(Z)-1-(4-iodophenyl)ethylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
| SMILES | COC[C@@H](C)NC(=S)N/N=C(/C)c1ccc(I)cc1 |
| InChI | InChI=1S/C13H18IN3OS/c1-9(8-18-3)15-13(19)17-16-10(2)11-4-6-12(14)7-5-11/h4-7,9H,8H2,1-3H3,(H2,15,17,19)/b16-10-/t9-/m1/s1 |
| InChIKey | OYQXSAZGBYCRQM-UIOUTNAGSA-N |
| XLogP | 2.51 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|