C15H23Cl2N3SSi — CID 177402804
1-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-3-(3-trimethylsilylpropyl)thiourea (PubChem CID 177402804) has the molecular formula C15H23Cl2N3SSi and a molecular weight of 376.43 g/mol. Its IUPAC name is 1-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-3-(3-trimethylsilylpropyl)thiourea.
| Compound Name | 1-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-3-(3-trimethylsilylpropyl)thiourea |
|---|---|
| PubChem CID | 177402804 |
| Molecular Formula | C15H23Cl2N3SSi |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 1-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-3-(3-trimethylsilylpropyl)thiourea |
| SMILES | C/C(=N\NC(=S)NCCC[Si](C)(C)C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H23Cl2N3SSi/c1-11(12-6-7-13(16)14(17)10-12)19-20-15(21)18-8-5-9-22(2,3)4/h6-7,10H,5,8-9H2,1-4H3,(H2,18,20,21)/b19-11+ |
| InChIKey | GTJJXJYVALVXNK-YBFXNURJSA-N |
| XLogP | 4.91 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|