C13H18FN3S — CID 3253568
1-butyl-3-[1-(4-fluorophenyl)ethylideneamino]thiourea (PubChem CID 3253568) has the molecular formula C13H18FN3S and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-butyl-3-[1-(4-fluorophenyl)ethylideneamino]thiourea.
| Compound Name | 1-butyl-3-[1-(4-fluorophenyl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 3253568 |
| Molecular Formula | C13H18FN3S |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-butyl-3-[1-(4-fluorophenyl)ethylideneamino]thiourea |
| SMILES | CCCCNC(=S)NN=C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FN3S/c1-3-4-9-15-13(18)17-16-10(2)11-5-7-12(14)8-6-11/h5-8H,3-4,9H2,1-2H3,(H2,15,17,18) |
| InChIKey | RVJHKBZUPNEDLF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|