C21H27N7S2 — CID 3005018
1-(1-phenylethylideneamino)-3-[4-[(1-pyridin-2-ylethylideneamino)carbamothioylamino]butyl]thiourea (PubChem CID 3005018) has the molecular formula C21H27N7S2 and a molecular weight of 441.63 g/mol. Its IUPAC name is 1-(1-phenylethylideneamino)-3-[4-[(1-pyridin-2-ylethylideneamino)carbamothioylamino]butyl]thiourea.
| Compound Name | 1-(1-phenylethylideneamino)-3-[4-[(1-pyridin-2-ylethylideneamino)carbamothioylamino]butyl]thiourea |
|---|---|
| PubChem CID | 3005018 |
| Molecular Formula | C21H27N7S2 |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 1-(1-phenylethylideneamino)-3-[4-[(1-pyridin-2-ylethylideneamino)carbamothioylamino]butyl]thiourea |
| SMILES | CC(=NNC(=S)NCCCCNC(=S)NN=C(C)c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C21H27N7S2/c1-16(18-10-4-3-5-11-18)25-27-20(29)23-14-8-9-15-24-21(30)28-26-17(2)19-12-6-7-13-22-19/h3-7,10-13H,8-9,14-15H2,1-2H3,(H2,23,27,29)(H2,24,28,30) |
| InChIKey | RRCVTTIFYFLLQR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|