C10H14CuN4S+2 — CID 50910440
copper 1-ethyl-3-(1-pyridin-2-ylethylideneamino)thiourea (PubChem CID 50910440) has the molecular formula C10H14CuN4S+2 and a molecular weight of 285.86 g/mol. Its IUPAC name is copper 1-ethyl-3-(1-pyridin-2-ylethylideneamino)thiourea.
| Compound Name | copper 1-ethyl-3-(1-pyridin-2-ylethylideneamino)thiourea |
|---|---|
| PubChem CID | 50910440 |
| Molecular Formula | C10H14CuN4S+2 |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | copper 1-ethyl-3-(1-pyridin-2-ylethylideneamino)thiourea |
| SMILES | CCNC(=S)NN=C(C)c1ccccn1.[Cu+2] |
| InChI | InChI=1S/C10H14N4S.Cu/c1-3-11-10(15)14-13-8(2)9-6-4-5-7-12-9;/h4-7H,3H2,1-2H3,(H2,11,14,15);/q;+2 |
| InChIKey | ZPYNSTXREJUTFL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|