C29H30N10S2 — CID 158902035
1-(dipyridin-2-ylmethylideneamino)-3-ethylthiourea;1-(dipyridin-2-ylmethylideneamino)-3-prop-2-enylthiourea (PubChem CID 158902035) has the molecular formula C29H30N10S2 and a molecular weight of 582.76 g/mol. Its IUPAC name is 1-(dipyridin-2-ylmethylideneamino)-3-ethylthiourea;1-(dipyridin-2-ylmethylideneamino)-3-prop-2-enylthiourea.
| Compound Name | 1-(dipyridin-2-ylmethylideneamino)-3-ethylthiourea;1-(dipyridin-2-ylmethylideneamino)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 158902035 |
| Molecular Formula | C29H30N10S2 |
| Molecular Weight | 582.76 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 1-(dipyridin-2-ylmethylideneamino)-3-ethylthiourea;1-(dipyridin-2-ylmethylideneamino)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NN=C(c1ccccn1)c1ccccn1.CCNC(=S)NN=C(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C15H15N5S.C14H15N5S/c1-2-9-18-15(21)20-19-14(12-7-3-5-10-16-12)13-8-4-6-11-17-13;1-2-15-14(20)19-18-13(11-7-3-5-9-16-11)12-8-4-6-10-17-12/h2-8,10-11H,1,9H2,(H2,18,20,21);3-10H,2H2,1H3,(H2,15,19,20) |
| InChIKey | JFOKPGCFRWUARC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 124.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.76 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|