C28H26N10S2 — CID 101026820
1-N,4-N-bis(dipyridin-2-ylmethylideneamino)piperazine-1,4-dicarbothioamide (PubChem CID 101026820) has the molecular formula C28H26N10S2 and a molecular weight of 566.72 g/mol. Its IUPAC name is 1-N,4-N-bis(dipyridin-2-ylmethylideneamino)piperazine-1,4-dicarbothioamide.
| Compound Name | 1-N,4-N-bis(dipyridin-2-ylmethylideneamino)piperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 101026820 |
| Molecular Formula | C28H26N10S2 |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 1-N,4-N-bis(dipyridin-2-ylmethylideneamino)piperazine-1,4-dicarbothioamide |
| SMILES | S=C(NN=C(c1ccccn1)c1ccccn1)N1CCN(C(=S)NN=C(c2ccccn2)c2ccccn2)CC1 |
| InChI | InChI=1S/C28H26N10S2/c39-27(35-33-25(21-9-1-5-13-29-21)22-10-2-6-14-30-22)37-17-19-38(20-18-37)28(40)36-34-26(23-11-3-7-15-31-23)24-12-4-8-16-32-24/h1-16H,17-20H2,(H,35,39)(H,36,40) |
| InChIKey | HZVUJPOHGYZKDM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|