C14H20Cl2GaN4S — CID 50935686
CID 50935686 (PubChem CID 50935686) has the molecular formula C14H20Cl2GaN4S and a molecular weight of 417.04 g/mol.
| Compound Name | CID 50935686 |
|---|---|
| PubChem CID | 50935686 |
| Molecular Formula | C14H20Cl2GaN4S |
| Molecular Weight | 417.04 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | — |
| SMILES | CC(=NNC(=S)N1CCCCCC1)c1ccccn1.Cl[Ga]Cl |
| InChI | InChI=1S/C14H20N4S.2ClH.Ga/c1-12(13-8-4-5-9-15-13)16-17-14(19)18-10-6-2-3-7-11-18;;;/h4-5,8-9H,2-3,6-7,10-11H2,1H3,(H,17,19);2*1H;/q;;;+2/p-2 |
| InChIKey | HTMGRNTZWMHWKL-UHFFFAOYSA-L |
| XLogP | 3.55 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.04 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|