C14H20GaN4S+3 — CID 50910578
gallium N-(1-pyridin-2-ylethylideneamino)azepane-1-carbothioamide (PubChem CID 50910578) has the molecular formula C14H20GaN4S+3 and a molecular weight of 346.13 g/mol. Its IUPAC name is gallium N-(1-pyridin-2-ylethylideneamino)azepane-1-carbothioamide.
| Compound Name | gallium N-(1-pyridin-2-ylethylideneamino)azepane-1-carbothioamide |
|---|---|
| PubChem CID | 50910578 |
| Molecular Formula | C14H20GaN4S+3 |
| Molecular Weight | 346.13 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | gallium N-(1-pyridin-2-ylethylideneamino)azepane-1-carbothioamide |
| SMILES | CC(=NNC(=S)N1CCCCCC1)c1ccccn1.[Ga+3] |
| InChI | InChI=1S/C14H20N4S.Ga/c1-12(13-8-4-5-9-15-13)16-17-14(19)18-10-6-2-3-7-11-18;/h4-5,8-9H,2-3,6-7,10-11H2,1H3,(H,17,19);/q;+3 |
| InChIKey | NSMYTNVGZUHZPQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.13 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|