C17H20N6S — CID 42636950
N-(dipyridin-2-ylmethylideneamino)-4-methylpiperazine-1-carbothioamide (PubChem CID 42636950) has the molecular formula C17H20N6S and a molecular weight of 340.46 g/mol. Its IUPAC name is N-(dipyridin-2-ylmethylideneamino)-4-methylpiperazine-1-carbothioamide.
| Compound Name | N-(dipyridin-2-ylmethylideneamino)-4-methylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 42636950 |
| Molecular Formula | C17H20N6S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-(dipyridin-2-ylmethylideneamino)-4-methylpiperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)NN=C(c2ccccn2)c2ccccn2)CC1 |
| InChI | InChI=1S/C17H20N6S/c1-22-10-12-23(13-11-22)17(24)21-20-16(14-6-2-4-8-18-14)15-7-3-5-9-19-15/h2-9H,10-13H2,1H3,(H,21,24) |
| InChIKey | DIAYYBCQRCKOHR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|