C26H24MnN10S2 — CID 25193515
bis(N-(dipyridin-2-ylmethylideneamino)-N'-methylcarbamimidothioate);manganese(2+) (PubChem CID 25193515) has the molecular formula C26H24MnN10S2 and a molecular weight of 595.62 g/mol. Its IUPAC name is bis(N-(dipyridin-2-ylmethylideneamino)-N'-methylcarbamimidothioate);manganese(2+).
| Compound Name | bis(N-(dipyridin-2-ylmethylideneamino)-N'-methylcarbamimidothioate);manganese(2+) |
|---|---|
| PubChem CID | 25193515 |
| Molecular Formula | C26H24MnN10S2 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.10 |
| IUPAC Name | bis(N-(dipyridin-2-ylmethylideneamino)-N'-methylcarbamimidothioate);manganese(2+) |
| SMILES | C/N=C(/[S-])NN=C(c1ccccn1)c1ccccn1.C/N=C(\[S-])NN=C(c1ccccn1)c1ccccn1.[Mn+2] |
| InChI | InChI=1S/2C13H13N5S.Mn/c2*1-14-13(19)18-17-12(10-6-2-4-8-15-10)11-7-3-5-9-16-11;/h2*2-9H,1H3,(H2,14,18,19);/q;;+2/p-2 |
| InChIKey | PQSAQSGMBPPNNM-UHFFFAOYSA-L |
| XLogP | 2.70 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|