C30H30FeN8S2 — CID 16749582
bis(N'-ethyl-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]carbamimidothioate);iron(2+) (PubChem CID 16749582) has the molecular formula C30H30FeN8S2 and a molecular weight of 622.61 g/mol. Its IUPAC name is bis(N'-ethyl-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]carbamimidothioate);iron(2+).
| Compound Name | bis(N'-ethyl-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]carbamimidothioate);iron(2+) |
|---|---|
| PubChem CID | 16749582 |
| Molecular Formula | C30H30FeN8S2 |
| Molecular Weight | 622.61 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | bis(N'-ethyl-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]carbamimidothioate);iron(2+) |
| SMILES | CC/N=C(/[S-])N/N=C(\c1ccccc1)c1ccccn1.CC/N=C(\[S-])N/N=C(\c1ccccc1)c1ccccn1.[Fe+2] |
| InChI | InChI=1S/2C15H16N4S.Fe/c2*1-2-16-15(20)19-18-14(12-8-4-3-5-9-12)13-10-6-7-11-17-13;/h2*3-11H,2H2,1H3,(H2,16,19,20);/q;;+2/p-2/b2*18-14+; |
| InChIKey | QBCIKXBZBDLJOI-UNNDGHNTSA-L |
| XLogP | 4.69 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|