About chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate
chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate (PubChem CID 50910622) has the molecular formula C14H13ClCuN3S2
and a molecular weight of 386.41 g/mol. Its IUPAC name is chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate.
Molecular Properties
| Compound Name | chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate |
| PubChem CID | 50910622 |
| Molecular Formula | C14H13ClCuN3S2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 384.95 |
| IUPAC Name | chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate |
| SMILES | CSC(=S)NN=C(c1ccccc1)c1ccccn1.Cl[Cu] |
| InChI | InChI=1S/C14H13N3S2.ClH.Cu/c1-19-14(18)17-16-13(11-7-3-2-4-8-11)12-9-5-6-10-15-12;;/h2-10H,1H3,(H,17,18);1H;/q;;+1/p-1 |
| InChIKey | LIWTWVIZKWXJLZ-UHFFFAOYSA-M |
| XLogP | 3.76 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate?
The IUPAC name of chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate (CID 50910622) is chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate.
What is the SMILES notation for chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate?
The canonical SMILES for chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate is CSC(=S)NN=C(c1ccccc1)c1ccccn1.Cl[Cu].
What is the InChIKey of chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate?
The InChIKey is LIWTWVIZKWXJLZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H13N3S2.ClH.Cu/c1-19-14(18)17-16-13(11-7-3-2-4-8-11)12-9-5-6-10-15-12;;/h2-10H,1H3,(H,17,18);1H;/q;;+1/p-1.
What are the key properties of chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate?
chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate has a molecular weight of 386.41 g/mol, XLogP of 3.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chlorocopper;methyl N-[[phenyl(pyridin-2-yl)methylidene]amino]carbamodithioate is sourced from PubChem (CID 50910622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).