C20H18N4S — CID 143919676
1-cyclohepta-1,3,5-trien-1-yl-3-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]thiourea (PubChem CID 143919676) has the molecular formula C20H18N4S and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-cyclohepta-1,3,5-trien-1-yl-3-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]thiourea.
| Compound Name | 1-cyclohepta-1,3,5-trien-1-yl-3-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]thiourea |
|---|---|
| PubChem CID | 143919676 |
| Molecular Formula | C20H18N4S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-cyclohepta-1,3,5-trien-1-yl-3-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]thiourea |
| SMILES | S=C(N/N=C(\c1ccccc1)c1ccccn1)NC1=CC=CC=CC1 |
| InChI | InChI=1S/C20H18N4S/c25-20(22-17-12-6-1-2-7-13-17)24-23-19(16-10-4-3-5-11-16)18-14-8-9-15-21-18/h1-12,14-15H,13H2,(H2,22,24,25)/b23-19+ |
| InChIKey | XEGMUDGRZHJOMC-FCDQGJHFSA-N |
| XLogP | 3.70 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|