C17H20Cl2CuN4S — CID 3005727
dichlorocopper;1,1-diethyl-3-[[phenyl(pyridin-2-yl)methylidene]amino]thiourea (PubChem CID 3005727) has the molecular formula C17H20Cl2CuN4S and a molecular weight of 446.89 g/mol. Its IUPAC name is dichlorocopper;1,1-diethyl-3-[[phenyl(pyridin-2-yl)methylidene]amino]thiourea.
| Compound Name | dichlorocopper;1,1-diethyl-3-[[phenyl(pyridin-2-yl)methylidene]amino]thiourea |
|---|---|
| PubChem CID | 3005727 |
| Molecular Formula | C17H20Cl2CuN4S |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | dichlorocopper;1,1-diethyl-3-[[phenyl(pyridin-2-yl)methylidene]amino]thiourea |
| SMILES | CCN(CC)C(=S)NN=C(c1ccccc1)c1ccccn1.Cl[Cu]Cl |
| InChI | InChI=1S/C17H20N4S.2ClH.Cu/c1-3-21(4-2)17(22)20-19-16(14-10-6-5-7-11-14)15-12-8-9-13-18-15;;;/h5-13H,3-4H2,1-2H3,(H,20,22);2*1H;/q;;;+2/p-2 |
| InChIKey | LJELTDNNYDQMOP-UHFFFAOYSA-L |
| XLogP | 4.43 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|