C19H15ClN4S — CID 3005029
1-(3-chlorophenyl)-3-[[phenyl(pyridin-2-yl)methylidene]amino]thiourea (PubChem CID 3005029) has the molecular formula C19H15ClN4S and a molecular weight of 366.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[phenyl(pyridin-2-yl)methylidene]amino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[[phenyl(pyridin-2-yl)methylidene]amino]thiourea |
|---|---|
| PubChem CID | 3005029 |
| Molecular Formula | C19H15ClN4S |
| Molecular Weight | 366.88 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[phenyl(pyridin-2-yl)methylidene]amino]thiourea |
| SMILES | S=C(NN=C(c1ccccc1)c1ccccn1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H15ClN4S/c20-15-9-6-10-16(13-15)22-19(25)24-23-18(14-7-2-1-3-8-14)17-11-4-5-12-21-17/h1-13H,(H2,22,24,25) |
| InChIKey | DDMBEZBBDVOBMQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|