C23H21Cl2N7S2 — CID 3005049
1-(3-chlorophenyl)-3-[1-[6-[N-[(3-chlorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea (PubChem CID 3005049) has the molecular formula C23H21Cl2N7S2 and a molecular weight of 530.51 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[1-[6-[N-[(3-chlorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[1-[6-[N-[(3-chlorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 3005049 |
| Molecular Formula | C23H21Cl2N7S2 |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 529.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[1-[6-[N-[(3-chlorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea |
| SMILES | CC(=NNC(=S)Nc1cccc(Cl)c1)c1cccc(C(C)=NNC(=S)Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C23H21Cl2N7S2/c1-14(29-31-22(33)26-18-8-3-6-16(24)12-18)20-10-5-11-21(28-20)15(2)30-32-23(34)27-19-9-4-7-17(25)13-19/h3-13H,1-2H3,(H2,26,31,33)(H2,27,32,34) |
| InChIKey | VXDVMNCTKRZPIF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|