C11H15N7S2 — CID 3940512
[1-[6-[N-(carbamothioylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea (PubChem CID 3940512) has the molecular formula C11H15N7S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is [1-[6-[N-(carbamothioylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea.
| Compound Name | [1-[6-[N-(carbamothioylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 3940512 |
| Molecular Formula | C11H15N7S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | [1-[6-[N-(carbamothioylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea |
| SMILES | CC(=NNC(N)=S)c1cccc(C(C)=NNC(N)=S)n1 |
| InChI | InChI=1S/C11H15N7S2/c1-6(15-17-10(12)19)8-4-3-5-9(14-8)7(2)16-18-11(13)20/h3-5H,1-2H3,(H3,12,17,19)(H3,13,18,20) |
| InChIKey | AKMAMTPCEONUFQ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 113.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|