About (1-pyridin-2-ylethylideneamino)thiourea;rhodium
(1-pyridin-2-ylethylideneamino)thiourea;rhodium (PubChem CID 175077366) has the molecular formula C8H10N4RhS
and a molecular weight of 297.17 g/mol. Its IUPAC name is (1-pyridin-2-ylethylideneamino)thiourea;rhodium.
Molecular Properties
| Compound Name | (1-pyridin-2-ylethylideneamino)thiourea;rhodium |
| PubChem CID | 175077366 |
| Molecular Formula | C8H10N4RhS |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | (1-pyridin-2-ylethylideneamino)thiourea;rhodium |
| SMILES | CC(=NNC(N)=S)c1ccccn1.[Rh] |
| InChI | InChI=1S/C8H10N4S.Rh/c1-6(11-12-8(9)13)7-4-2-3-5-10-7;/h2-5H,1H3,(H3,9,12,13); |
| InChIKey | NGAGKJMSZYEWJS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1-pyridin-2-ylethylideneamino)thiourea;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-pyridin-2-ylethylideneamino)thiourea;rhodium?
The IUPAC name of (1-pyridin-2-ylethylideneamino)thiourea;rhodium (CID 175077366) is (1-pyridin-2-ylethylideneamino)thiourea;rhodium.
What is the SMILES notation for (1-pyridin-2-ylethylideneamino)thiourea;rhodium?
The canonical SMILES for (1-pyridin-2-ylethylideneamino)thiourea;rhodium is CC(=NNC(N)=S)c1ccccn1.[Rh].
What is the InChIKey of (1-pyridin-2-ylethylideneamino)thiourea;rhodium?
The InChIKey is NGAGKJMSZYEWJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S.Rh/c1-6(11-12-8(9)13)7-4-2-3-5-10-7;/h2-5H,1H3,(H3,9,12,13);.
What are the key properties of (1-pyridin-2-ylethylideneamino)thiourea;rhodium?
(1-pyridin-2-ylethylideneamino)thiourea;rhodium has a molecular weight of 297.17 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-pyridin-2-ylethylideneamino)thiourea;rhodium is sourced from PubChem (CID 175077366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).