C10H14BrCuN4S+ — CID 50919901
bromocopper(1+);1,1-dimethyl-3-(1-pyridin-2-ylethylideneamino)thiourea (PubChem CID 50919901) has the molecular formula C10H14BrCuN4S+ and a molecular weight of 365.77 g/mol. Its IUPAC name is bromocopper(1+);1,1-dimethyl-3-(1-pyridin-2-ylethylideneamino)thiourea.
| Compound Name | bromocopper(1+);1,1-dimethyl-3-(1-pyridin-2-ylethylideneamino)thiourea |
|---|---|
| PubChem CID | 50919901 |
| Molecular Formula | C10H14BrCuN4S+ |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | bromocopper(1+);1,1-dimethyl-3-(1-pyridin-2-ylethylideneamino)thiourea |
| SMILES | CC(=NNC(=S)N(C)C)c1ccccn1.[Cu+]Br |
| InChI | InChI=1S/C10H14N4S.BrH.Cu/c1-8(9-6-4-5-7-11-9)12-13-10(15)14(2)3;;/h4-7H,1-3H3,(H,13,15);1H;/q;;+2/p-1 |
| InChIKey | AUEWNZKEFYYMDI-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|