C16H19CuN5S+2 — CID 50910226
copper 1-methyl-1-(2-pyridin-2-ylethyl)-3-(1-pyridin-2-ylethylideneamino)thiourea (PubChem CID 50910226) has the molecular formula C16H19CuN5S+2 and a molecular weight of 376.98 g/mol. Its IUPAC name is copper 1-methyl-1-(2-pyridin-2-ylethyl)-3-(1-pyridin-2-ylethylideneamino)thiourea.
| Compound Name | copper 1-methyl-1-(2-pyridin-2-ylethyl)-3-(1-pyridin-2-ylethylideneamino)thiourea |
|---|---|
| PubChem CID | 50910226 |
| Molecular Formula | C16H19CuN5S+2 |
| Molecular Weight | 376.98 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | copper 1-methyl-1-(2-pyridin-2-ylethyl)-3-(1-pyridin-2-ylethylideneamino)thiourea |
| SMILES | CC(=NNC(=S)N(C)CCc1ccccn1)c1ccccn1.[Cu+2] |
| InChI | InChI=1S/C16H19N5S.Cu/c1-13(15-8-4-6-11-18-15)19-20-16(22)21(2)12-9-14-7-3-5-10-17-14;/h3-8,10-11H,9,12H2,1-2H3,(H,20,22);/q;+2 |
| InChIKey | HOZASYGFDMSJFO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.98 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|