C15H18N6S — CID 5481307
1-methyl-3-[(Z)-1-pyrazin-2-ylethylideneamino]-1-(2-pyridin-2-ylethyl)thiourea (PubChem CID 5481307) has the molecular formula C15H18N6S and a molecular weight of 314.42 g/mol. Its IUPAC name is 1-methyl-3-[(Z)-1-pyrazin-2-ylethylideneamino]-1-(2-pyridin-2-ylethyl)thiourea.
| Compound Name | 1-methyl-3-[(Z)-1-pyrazin-2-ylethylideneamino]-1-(2-pyridin-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 5481307 |
| Molecular Formula | C15H18N6S |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-methyl-3-[(Z)-1-pyrazin-2-ylethylideneamino]-1-(2-pyridin-2-ylethyl)thiourea |
| SMILES | C/C(=N/NC(=S)N(C)CCc1ccccn1)c1cnccn1 |
| InChI | InChI=1S/C15H18N6S/c1-12(14-11-16-8-9-18-14)19-20-15(22)21(2)10-6-13-5-3-4-7-17-13/h3-5,7-9,11H,6,10H2,1-2H3,(H,20,22)/b19-12- |
| InChIKey | XOBZUWSLRXMZNN-UNOMPAQXSA-N |
| XLogP | 1.64 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|