C8H11N5S — CID 5375900
1-methyl-3-[(E)-1-pyrazin-2-ylethylideneamino]thiourea (PubChem CID 5375900) has the molecular formula C8H11N5S and a molecular weight of 209.28 g/mol. Its IUPAC name is 1-methyl-3-[(E)-1-pyrazin-2-ylethylideneamino]thiourea.
| Compound Name | 1-methyl-3-[(E)-1-pyrazin-2-ylethylideneamino]thiourea |
|---|---|
| PubChem CID | 5375900 |
| Molecular Formula | C8H11N5S |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-methyl-3-[(E)-1-pyrazin-2-ylethylideneamino]thiourea |
| SMILES | CNC(=S)N/N=C(\C)c1cnccn1 |
| InChI | InChI=1S/C8H11N5S/c1-6(12-13-8(14)9-2)7-5-10-3-4-11-7/h3-5H,1-2H3,(H2,9,13,14)/b12-6+ |
| InChIKey | GLPQYBREVOHZTO-WUXMJOGZSA-N |
| XLogP | 0.29 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|