About dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea
dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea (PubChem CID 3005689) has the molecular formula C8H11Cl2CuN5S
and a molecular weight of 343.73 g/mol. Its IUPAC name is dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea.
Molecular Properties
| Compound Name | dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea |
| PubChem CID | 3005689 |
| Molecular Formula | C8H11Cl2CuN5S |
| Molecular Weight | 343.73 g/mol |
| Exact Mass | 341.94 |
| IUPAC Name | dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea |
| SMILES | CNC(=S)NN=C(C)c1cnccn1.Cl[Cu]Cl |
| InChI | InChI=1S/C8H11N5S.2ClH.Cu/c1-6(12-13-8(14)9-2)7-5-10-3-4-11-7;;;/h3-5H,1-2H3,(H2,9,13,14);2*1H;/q;;;+2/p-2 |
| InChIKey | QDDYSNVKNSALPF-UHFFFAOYSA-L |
| XLogP | 1.67 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.73 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea?
The IUPAC name of dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea (CID 3005689) is dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea.
What is the SMILES notation for dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea?
The canonical SMILES for dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea is CNC(=S)NN=C(C)c1cnccn1.Cl[Cu]Cl.
What is the InChIKey of dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea?
The InChIKey is QDDYSNVKNSALPF-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H11N5S.2ClH.Cu/c1-6(12-13-8(14)9-2)7-5-10-3-4-11-7;;;/h3-5H,1-2H3,(H2,9,13,14);2*1H;/q;;;+2/p-2.
What are the key properties of dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea?
dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea has a molecular weight of 343.73 g/mol, XLogP of 1.67, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocopper;1-methyl-3-(1-pyrazin-2-ylethylideneamino)thiourea is sourced from PubChem (CID 3005689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).