C30H30N6S4Zn — CID 50919422
bis(benzyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate);zinc (PubChem CID 50919422) has the molecular formula C30H30N6S4Zn and a molecular weight of 668.27 g/mol. Its IUPAC name is bis(benzyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate);zinc.
| Compound Name | bis(benzyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate);zinc |
|---|---|
| PubChem CID | 50919422 |
| Molecular Formula | C30H30N6S4Zn |
| Molecular Weight | 668.27 g/mol |
| Exact Mass | 666.07 |
| IUPAC Name | bis(benzyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate);zinc |
| SMILES | CC(=NNC(=S)SCc1ccccc1)c1ccccn1.CC(=NNC(=S)SCc1ccccc1)c1ccccn1.[Zn] |
| InChI | InChI=1S/2C15H15N3S2.Zn/c2*1-12(14-9-5-6-10-16-14)17-18-15(19)20-11-13-7-3-2-4-8-13;/h2*2-10H,11H2,1H3,(H,18,19); |
| InChIKey | LKYSATCSJTXQDG-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.27 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|