C30H30CuN6S4 — CID 50911424
bis(benzyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate);copper (PubChem CID 50911424) has the molecular formula C30H30CuN6S4 and a molecular weight of 666.43 g/mol. Its IUPAC name is bis(benzyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate);copper.
| Compound Name | bis(benzyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate);copper |
|---|---|
| PubChem CID | 50911424 |
| Molecular Formula | C30H30CuN6S4 |
| Molecular Weight | 666.43 g/mol |
| Exact Mass | 665.07 |
| IUPAC Name | bis(benzyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate);copper |
| SMILES | CC(=NNC(=S)SCc1ccccc1)c1ccccn1.CC(=NNC(=S)SCc1ccccc1)c1ccccn1.[Cu] |
| InChI | InChI=1S/2C15H15N3S2.Cu/c2*1-12(14-9-5-6-10-16-14)17-18-15(19)20-11-13-7-3-2-4-8-13;/h2*2-10H,11H2,1H3,(H,18,19); |
| InChIKey | RILJICAFHDFUIQ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.43 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|