About dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide
dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide (PubChem CID 50911516) has the molecular formula C9H12Cl2N3ORhS2-
and a molecular weight of 416.16 g/mol. Its IUPAC name is dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide.
Molecular Properties
| Compound Name | dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide |
| PubChem CID | 50911516 |
| Molecular Formula | C9H12Cl2N3ORhS2- |
| Molecular Weight | 416.16 g/mol |
| Exact Mass | 414.89 |
| IUPAC Name | dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide |
| SMILES | CSC(=S)NN=C(C)c1ccccn1.Cl[Rh]Cl.[OH-] |
| InChI | InChI=1S/C9H11N3S2.2ClH.H2O.Rh/c1-7(11-12-9(13)14-2)8-5-3-4-6-10-8;;;;/h3-6H,1-2H3,(H,12,13);2*1H;1H2;/q;;;;+2/p-3 |
| InChIKey | KBAYBKXRUYNCFD-UHFFFAOYSA-K |
| XLogP | 3.24 |
| TPSA | 67.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide?
The IUPAC name of dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide (CID 50911516) is dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide.
What is the SMILES notation for dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide?
The canonical SMILES for dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide is CSC(=S)NN=C(C)c1ccccn1.Cl[Rh]Cl.[OH-].
What is the InChIKey of dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide?
The InChIKey is KBAYBKXRUYNCFD-UHFFFAOYSA-K. The full InChI is InChI=1S/C9H11N3S2.2ClH.H2O.Rh/c1-7(11-12-9(13)14-2)8-5-3-4-6-10-8;;;;/h3-6H,1-2H3,(H,12,13);2*1H;1H2;/q;;;;+2/p-3.
What are the key properties of dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide?
dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide has a molecular weight of 416.16 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dichlororhodium;methyl N-(1-pyridin-2-ylethylideneamino)carbamodithioate;hydroxide is sourced from PubChem (CID 50911516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).