C32H36N6S4Sn — CID 20843990
benzyl N-[(Z)-1-pyridin-2-ylethylideneamino]carbamodithioate;benzyl N-[(E)-1-pyridin-2-ylethylideneamino]carbamodithioate;dimethyltin (PubChem CID 20843990) has the molecular formula C32H36N6S4Sn and a molecular weight of 751.66 g/mol. Its IUPAC name is benzyl N-[(Z)-1-pyridin-2-ylethylideneamino]carbamodithioate;benzyl N-[(E)-1-pyridin-2-ylethylideneamino]carbamodithioate;dimethyltin.
| Compound Name | benzyl N-[(Z)-1-pyridin-2-ylethylideneamino]carbamodithioate;benzyl N-[(E)-1-pyridin-2-ylethylideneamino]carbamodithioate;dimethyltin |
|---|---|
| PubChem CID | 20843990 |
| Molecular Formula | C32H36N6S4Sn |
| Molecular Weight | 751.66 g/mol |
| Exact Mass | 752.09 |
| IUPAC Name | benzyl N-[(Z)-1-pyridin-2-ylethylideneamino]carbamodithioate;benzyl N-[(E)-1-pyridin-2-ylethylideneamino]carbamodithioate;dimethyltin |
| SMILES | C/C(=N/NC(=S)SCc1ccccc1)c1ccccn1.C/C(=N\NC(=S)SCc1ccccc1)c1ccccn1.C[Sn]C |
| InChI | InChI=1S/2C15H15N3S2.2CH3.Sn/c2*1-12(14-9-5-6-10-16-14)17-18-15(19)20-11-13-7-3-2-4-8-13;;;/h2*2-10H,11H2,1H3,(H,18,19);2*1H3;/b17-12+;17-12-;;; |
| InChIKey | RQMHXZJFHLZGKF-LDQSNFCSSA-N |
| XLogP | 8.01 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.66 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|