C17H20N4OS — CID 20845582
1-methyl-1-(2-phenylethylsulfanyl)-3-[(Z)-1-pyridin-2-ylethylideneamino]urea (PubChem CID 20845582) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is 1-methyl-1-(2-phenylethylsulfanyl)-3-[(Z)-1-pyridin-2-ylethylideneamino]urea.
| Compound Name | 1-methyl-1-(2-phenylethylsulfanyl)-3-[(Z)-1-pyridin-2-ylethylideneamino]urea |
|---|---|
| PubChem CID | 20845582 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-methyl-1-(2-phenylethylsulfanyl)-3-[(Z)-1-pyridin-2-ylethylideneamino]urea |
| SMILES | C/C(=N/NC(=O)N(C)SCCc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C17H20N4OS/c1-14(16-10-6-7-12-18-16)19-20-17(22)21(2)23-13-11-15-8-4-3-5-9-15/h3-10,12H,11,13H2,1-2H3,(H,20,22)/b19-14- |
| InChIKey | YXZLMWNNVYPQBZ-RGEXLXHISA-N |
| XLogP | 3.34 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|