About 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide
2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide (PubChem CID 123895161) has the molecular formula C10H15N5
and a molecular weight of 205.27 g/mol. Its IUPAC name is 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide.
Molecular Properties
| Compound Name | 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide |
| PubChem CID | 123895161 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide |
| SMILES | C/N=C(\CN)N/N=C(/C)c1ccccn1 |
| InChI | InChI=1S/C10H15N5/c1-8(9-5-3-4-6-13-9)14-15-10(7-11)12-2/h3-6H,7,11H2,1-2H3,(H,12,15)/b14-8- |
| InChIKey | KASPDMRECSIVHJ-ZSOIEALJSA-N |
| XLogP | 0.38 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide?
The IUPAC name of 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide (CID 123895161) is 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide.
What is the SMILES notation for 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide?
The canonical SMILES for 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide is C/N=C(\CN)N/N=C(/C)c1ccccn1.
What is the InChIKey of 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide?
The InChIKey is KASPDMRECSIVHJ-ZSOIEALJSA-N. The full InChI is InChI=1S/C10H15N5/c1-8(9-5-3-4-6-13-9)14-15-10(7-11)12-2/h3-6H,7,11H2,1-2H3,(H,12,15)/b14-8-.
What are the key properties of 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide?
2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide has a molecular weight of 205.27 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N'-methyl-N-[(Z)-1-pyridin-2-ylethylideneamino]ethanimidamide is sourced from PubChem (CID 123895161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).