C23H35N7S2 — CID 162344959
1-cyclohexyl-3-[1-[6-[N-(cyclohexylcarbamothioylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea (PubChem CID 162344959) has the molecular formula C23H35N7S2 and a molecular weight of 473.72 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-[6-[N-(cyclohexylcarbamothioylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[1-[6-[N-(cyclohexylcarbamothioylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 162344959 |
| Molecular Formula | C23H35N7S2 |
| Molecular Weight | 473.72 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 1-cyclohexyl-3-[1-[6-[N-(cyclohexylcarbamothioylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]thiourea |
| SMILES | CC(=NNC(=S)NC1CCCCC1)c1cccc(C(C)=NNC(=S)NC2CCCCC2)n1 |
| InChI | InChI=1S/C23H35N7S2/c1-16(27-29-22(31)24-18-10-5-3-6-11-18)20-14-9-15-21(26-20)17(2)28-30-23(32)25-19-12-7-4-8-13-19/h9,14-15,18-19H,3-8,10-13H2,1-2H3,(H2,24,29,31)(H2,25,30,32) |
| InChIKey | HAYXVEKOOLVBOU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.72 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|