C20H22FN3S — CID 17337965
1-cyclohexyl-3-[(E)-[(4-fluorophenyl)-phenylmethylidene]amino]thiourea (PubChem CID 17337965) has the molecular formula C20H22FN3S and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(E)-[(4-fluorophenyl)-phenylmethylidene]amino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(E)-[(4-fluorophenyl)-phenylmethylidene]amino]thiourea |
|---|---|
| PubChem CID | 17337965 |
| Molecular Formula | C20H22FN3S |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-cyclohexyl-3-[(E)-[(4-fluorophenyl)-phenylmethylidene]amino]thiourea |
| SMILES | Fc1ccc(/C(=N/NC(=S)NC2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22FN3S/c21-17-13-11-16(12-14-17)19(15-7-3-1-4-8-15)23-24-20(25)22-18-9-5-2-6-10-18/h1,3-4,7-8,11-14,18H,2,5-6,9-10H2,(H2,22,24,25)/b23-19+ |
| InChIKey | VLCFCXIHMRQSBR-FCDQGJHFSA-N |
| XLogP | 4.37 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|