C24H25FN4OS — CID 6903729
1-cyclohexyl-3-[(E)-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]thiourea (PubChem CID 6903729) has the molecular formula C24H25FN4OS and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(E)-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(E)-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 6903729 |
| Molecular Formula | C24H25FN4OS |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 1-cyclohexyl-3-[(E)-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]thiourea |
| SMILES | Cc1c(/C=N/NC(=S)NC2CCCCC2)c2ccccn2c1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H25FN4OS/c1-16-20(15-26-28-24(31)27-19-7-3-2-4-8-19)21-9-5-6-14-29(21)22(16)23(30)17-10-12-18(25)13-11-17/h5-6,9-15,19H,2-4,7-8H2,1H3,(H2,27,28,31)/b26-15+ |
| InChIKey | XIEROJWDOVGGFB-CVKSISIWSA-N |
| XLogP | 4.75 |
| TPSA | 57.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|