C24H18BrN3O2 — CID 2312208
N-[(3-benzoyl-2-methylindolizin-1-yl)methylideneamino]-4-bromobenzamide (PubChem CID 2312208) has the molecular formula C24H18BrN3O2 and a molecular weight of 460.33 g/mol. Its IUPAC name is N-[(3-benzoyl-2-methylindolizin-1-yl)methylideneamino]-4-bromobenzamide.
| Compound Name | N-[(3-benzoyl-2-methylindolizin-1-yl)methylideneamino]-4-bromobenzamide |
|---|---|
| PubChem CID | 2312208 |
| Molecular Formula | C24H18BrN3O2 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | N-[(3-benzoyl-2-methylindolizin-1-yl)methylideneamino]-4-bromobenzamide |
| SMILES | Cc1c(C=NNC(=O)c2ccc(Br)cc2)c2ccccn2c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H18BrN3O2/c1-16-20(15-26-27-24(30)18-10-12-19(25)13-11-18)21-9-5-6-14-28(21)22(16)23(29)17-7-3-2-4-8-17/h2-15H,1H3,(H,27,30) |
| InChIKey | SXQYCMSINZJXRV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|