C24H16F4N4O3 — CID 4638945
(4-fluorophenyl)-[2-methyl-1-[[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indolizin-3-yl]methanone (PubChem CID 4638945) has the molecular formula C24H16F4N4O3 and a molecular weight of 484.41 g/mol. Its IUPAC name is (4-fluorophenyl)-[2-methyl-1-[[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indolizin-3-yl]methanone.
| Compound Name | (4-fluorophenyl)-[2-methyl-1-[[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indolizin-3-yl]methanone |
|---|---|
| PubChem CID | 4638945 |
| Molecular Formula | C24H16F4N4O3 |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | (4-fluorophenyl)-[2-methyl-1-[[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indolizin-3-yl]methanone |
| SMILES | Cc1c(C=NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c2ccccn2c1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H16F4N4O3/c1-14-18(13-29-30-19-10-7-16(24(26,27)28)12-21(19)32(34)35)20-4-2-3-11-31(20)22(14)23(33)15-5-8-17(25)9-6-15/h2-13,30H,1H3 |
| InChIKey | TUVIQKTXNJAXQH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|