C24H19F3N4O2 — CID 126074171
N-[(Z)-(1-benzyl-2-methylindol-3-yl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126074171) has the molecular formula C24H19F3N4O2 and a molecular weight of 452.44 g/mol. Its IUPAC name is N-[(Z)-(1-benzyl-2-methylindol-3-yl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-(1-benzyl-2-methylindol-3-yl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126074171 |
| Molecular Formula | C24H19F3N4O2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[(Z)-(1-benzyl-2-methylindol-3-yl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | Cc1c(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H19F3N4O2/c1-16-20(14-28-29-21-12-11-18(24(25,26)27)13-23(21)31(32)33)19-9-5-6-10-22(19)30(16)15-17-7-3-2-4-8-17/h2-14,29H,15H2,1H3/b28-14- |
| InChIKey | PYHIFIJWQKKUBH-MUXKCCDJSA-N |
| XLogP | 6.37 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|