C23H17F3N4O5 — CID 126395958
methyl 5-[[3-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate (PubChem CID 126395958) has the molecular formula C23H17F3N4O5 and a molecular weight of 486.41 g/mol. Its IUPAC name is methyl 5-[[3-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[3-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126395958 |
| Molecular Formula | C23H17F3N4O5 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | methyl 5-[[3-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2cc(/C=N/Nc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c3ccccc32)o1 |
| InChI | InChI=1S/C23H17F3N4O5/c1-34-22(31)21-9-7-16(35-21)13-29-12-14(17-4-2-3-5-19(17)29)11-27-28-18-8-6-15(23(24,25)26)10-20(18)30(32)33/h2-12,28H,13H2,1H3/b27-11+ |
| InChIKey | ICNXNBPLTPQBBI-LUOAPIJWSA-N |
| XLogP | 5.44 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|