C25H17F3N2O3 — CID 126396148
methyl 5-[[3-[(E)-2-cyano-2-[4-(trifluoromethyl)phenyl]ethenyl]indol-1-yl]methyl]furan-2-carboxylate (PubChem CID 126396148) has the molecular formula C25H17F3N2O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is methyl 5-[[3-[(E)-2-cyano-2-[4-(trifluoromethyl)phenyl]ethenyl]indol-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[3-[(E)-2-cyano-2-[4-(trifluoromethyl)phenyl]ethenyl]indol-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126396148 |
| Molecular Formula | C25H17F3N2O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | methyl 5-[[3-[(E)-2-cyano-2-[4-(trifluoromethyl)phenyl]ethenyl]indol-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2cc(/C=C(/C#N)c3ccc(C(F)(F)F)cc3)c3ccccc32)o1 |
| InChI | InChI=1S/C25H17F3N2O3/c1-32-24(31)23-11-10-20(33-23)15-30-14-18(21-4-2-3-5-22(21)30)12-17(13-29)16-6-8-19(9-7-16)25(26,27)28/h2-12,14H,15H2,1H3/b17-12- |
| InChIKey | IXQZXVUCZFBLHO-ATVHPVEESA-N |
| XLogP | 6.15 |
| TPSA | 68.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|