C26H24N2S — CID 91231014
3-[1-[(4-tert-butylphenyl)methyl]indol-3-yl]-2-thiophen-3-ylprop-2-enenitrile (PubChem CID 91231014) has the molecular formula C26H24N2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 3-[1-[(4-tert-butylphenyl)methyl]indol-3-yl]-2-thiophen-3-ylprop-2-enenitrile.
| Compound Name | 3-[1-[(4-tert-butylphenyl)methyl]indol-3-yl]-2-thiophen-3-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 91231014 |
| Molecular Formula | C26H24N2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3-[1-[(4-tert-butylphenyl)methyl]indol-3-yl]-2-thiophen-3-ylprop-2-enenitrile |
| SMILES | CC(C)(C)c1ccc(Cn2cc(C=C(C#N)c3ccsc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H24N2S/c1-26(2,3)23-10-8-19(9-11-23)16-28-17-22(24-6-4-5-7-25(24)28)14-21(15-27)20-12-13-29-18-20/h4-14,17-18H,16H2,1-3H3 |
| InChIKey | IIRHGAZGVWSKQF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|