C22H15F3N4O5 — CID 17311301
5-[[3-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid (PubChem CID 17311301) has the molecular formula C22H15F3N4O5 and a molecular weight of 472.38 g/mol. Its IUPAC name is 5-[[3-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[3-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 17311301 |
| Molecular Formula | C22H15F3N4O5 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 5-[[3-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cn2cc(/C=N/Nc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c3ccccc32)o1 |
| InChI | InChI=1S/C22H15F3N4O5/c23-22(24,25)14-5-7-17(19(9-14)29(32)33)27-26-10-13-11-28(18-4-2-1-3-16(13)18)12-15-6-8-20(34-15)21(30)31/h1-11,27H,12H2,(H,30,31)/b26-10+ |
| InChIKey | BVKUYWYYPFRLGG-NSKAYECMSA-N |
| XLogP | 5.35 |
| TPSA | 122.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|